Difference between revisions of "BSUBPOLYAMSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* common name: | * common name: | ||
− | ** | + | ** spermidine biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** arginine degradation to spermidine |
− | ** | + | ** spermidine biosynthesis |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN | + | '''2''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[SAMDECARB-RXN]] | |
− | * [[ | + | ** 2 associated gene(s): |
− | + | *** [[Tiso_gene_4269]] | |
− | * [[ | + | *** [[Tiso_gene_11030]] |
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_17803]] | ||
+ | *** [[Tiso_gene_16717]] | ||
+ | *** [[Tiso_gene_16718]] | ||
+ | *** [[Tiso_gene_17081]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY] | |
− | ** [http:// | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=BSUBPOLYAMSYN-PWY BSUBPOLYAMSYN-PWY] | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | * | + | {{#set: taxonomic range=TAX-2157}} |
− | ** [http:// | + | {{#set: common name=spermidine biosynthesis I}} |
− | + | {{#set: common name=arginine degradation to spermidine|spermidine biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=2}} | |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:48, 21 March 2018
Pathway BSUBPOLYAMSYN-PWY
- taxonomic range:
- common name:
- spermidine biosynthesis I
- Synonym(s):
- arginine degradation to spermidine
- spermidine biosynthesis
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- SAMDECARB-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- SPERMIDINESYN-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
- ARACYC: