Difference between revisions of "CPD0-2015"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16313 RXN-16313] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * common name: ** Nα-acetyl-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16313 RXN-16313] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NC(CCSC)C([O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.2.24 EC-2.3.2.24]
+
** Nα-acetyl-L-methionine
 +
* inchi key:
 +
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
 +
* molecular weight:
 +
** 190.237   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-L-methionine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[S-ubiquitinyl-E3-independent-E2-Cys]][c] '''+''' 1 [[Protein-L-lysine]][c] '''=>''' 1 [[E3-independent-Ubiquitin-E2-L-cysteine]][c] '''+''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN0-6948]]
−
* With common name(s):
+
* [[RXN-17893]]
−
** 1 an S-ubiquitinyl-[(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''+''' 1 a [protein]-L-lysine[c] '''=>''' 1 an [(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''+''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c] '''+''' 1 H+[c]
+
* [[RXN-17892]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB01646
−
{{#set: ec number=EC-2.3.2.24}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-7511}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
−
{{#set: reconstruction category=annotation}}
+
* HMDB : HMDB11745
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
 +
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
 +
{{#set: common name=Nα-acetyl-L-methionine}}
 +
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
 +
{{#set: molecular weight=190.237    }}
 +
{{#set: common name=N-acetyl-L-methionine}}
 +
{{#set: produced by=RXN0-6948|RXN-17893|RXN-17892}}

Latest revision as of 20:49, 21 March 2018

Metabolite CPD0-2015

  • smiles:
    • CC(=O)NC(CCSC)C([O-])=O
  • common name:
    • Nα-acetyl-L-methionine
  • inchi key:
    • InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
  • molecular weight:
    • 190.237
  • Synonym(s):
    • N-acetyl-L-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC(CCSC)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-2015&oldid=43953"