Difference between revisions of "Tiso gene 10318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
(Created page with "Category:Gene == Gene Tiso_gene_10318 == * right end position: ** 5368 * transcription direction: ** POSITIVE * left end position: ** 3669 * centisome position: ** 32.1250...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
+
== Gene Tiso_gene_10318 ==
−
* smiles:
+
* right end position:
−
** CC(=O)NC(CCSC)C([O-])=O
+
** 5368
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** Nα-acetyl-L-methionine
+
** 3669
−
* molecular weight:
+
* centisome position:
−
** 190.237    
+
** 32.12503    
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-L-methionine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[NQOR-RXN]]
−
* [[RXN0-6948]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-17893]]
+
*** Assignment: ec-number
−
* [[RXN-17892]]
+
* Reaction: [[RXN-12303]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7731]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01646
+
{{#set: right end position=5368}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
+
{{#set: left end position=3669}}
−
* HMDB : HMDB11745
+
{{#set: centisome position=32.12503   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=NQOR-RXN|RXN-12303}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
+
{{#set: pathway associated=PWY-7731}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
+
−
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
+
−
{{#set: common name=Nα-acetyl-L-methionine}}
+
−
{{#set: molecular weight=190.237   }}
+
−
{{#set: common name=N-acetyl-L-methionine}}
+
−
{{#set: produced by=RXN0-6948|RXN-17893|RXN-17892}}
+

Latest revision as of 19:49, 21 March 2018

Gene Tiso_gene_10318

  • right end position:
    • 5368
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3669
  • centisome position:
    • 32.12503
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10318&oldid=43984"