Difference between revisions of "RXN-12968"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * smiles: ** C(CC(=O)OCCC(C([O-])=O)[N+])C(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12968 RXN-12968] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12968 RXN-12968] ==
−
* smiles:
+
* direction:
−
** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
−
** O-succinyl-L-homoserine
+
** chloroplast_beta-keto_acyl_reductase
−
* molecular weight:
+
* ec number:
−
** 218.186   
+
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
 
* Synonym(s):
 
* Synonym(s):
−
** O-succinyl-homoserine
 
−
** succinyl-homoserine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[SUCHMSSELCYSLh]]
+
* With identifiers:
−
* [[METBALT-RXN]]
+
** 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CPD-14404]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-14405]][c]
−
* [[SUCHMSSELCYSL]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 NAD(P)H[c] '''+''' 1 3-oxo-dihomo γ-linolenoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 NAD(P)+[c] '''+''' 1 3R-hydroxy-dihomo γ-linolenoyl-CoA[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[O-SUCCHOMOSERLYASE-RXN]]
+
== Genes associated with this reaction  ==
−
* [[RXN-9384]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9871]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5353]], arachidonate biosynthesis I (6-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-7592]], arachidonate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7592 PWY-7592]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1492-23-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420]
+
{{#set: ec number=EC-1.1.1.330}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_9871}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661]
+
{{#set: in pathway=PWY-5353|PWY-7592}}
−
* BIGG : suchms
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}}
+
−
{{#set: common name=O-succinyl-L-homoserine}}
+
−
{{#set: molecular weight=218.186    }}
+
−
{{#set: common name=O-succinyl-homoserine|succinyl-homoserine}}
+
−
{{#set: consumed by=SUCHMSSELCYSLh|METBALT-RXN|SUCHMSSELCYSL}}
+
−
{{#set: consumed or produced by=O-SUCCHOMOSERLYASE-RXN|RXN-9384}}
+

Latest revision as of 19:17, 21 March 2018

Reaction RXN-12968

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chloroplast_beta-keto_acyl_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD(P)H[c] + 1 3-oxo-dihomo γ-linolenoyl-CoA[c] + 1 H+[c] => 1 NAD(P)+[c] + 1 3R-hydroxy-dihomo γ-linolenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5353, arachidonate biosynthesis I (6-desaturase, lower eukaryotes): PWY-5353
    • 3 reactions found over 8 reactions in the full pathway
  • PWY-7592, arachidonate biosynthesis III (6-desaturase, mammals): PWY-7592
    • 2 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12968&oldid=40683"