Difference between revisions of "CPD-11398"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FERREDOXIN--NITRITE-REDUCTASE-RXN FERREDOXIN--NITRITE-REDUCTASE-RXN] == * direction: ** LEFT-TO-RIG...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FERREDOXIN--NITRITE-REDUCTASE-RXN FERREDOXIN--NITRITE-REDUCTASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
 
* common name:
 
* common name:
−
** nitrite_reductase
+
** L-thyroxine phenolic β-D-glucuronide
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.7.7.1 EC-1.7.7.1]
+
** InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
 +
* molecular weight:
 +
** 951.992   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-thyroxine phenolic glucuronide
 +
** thyroxine glucuronide
 +
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
 +
** T4G
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 8 [[PROTON]][c] '''+''' 1 [[NITRITE]][c] '''+''' 6 [[Reduced-ferredoxins]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 6 [[Oxidized-ferredoxins]][c]
+
* [[RXN-10606]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 8 H+[c] '''+''' 1 nitrite[c] '''+''' 6 a reduced ferredoxin [iron-sulfur] cluster[c] '''=>''' 2 H2O[c] '''+''' 1 ammonium[c] '''+''' 6 an oxidized ferredoxin [iron-sulfur] cluster[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7919]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-381]], nitrate reduction II (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY490-3]], nitrate reduction VI (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00790 R00790]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237176 44237176]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
−
{{#set: common name=nitrite_reductase}}
+
{{#set: common name=L-thyroxine phenolic β-D-glucuronide}}
−
{{#set: ec number=EC-1.7.7.1}}
+
{{#set: inchi key=InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M}}
−
{{#set: gene associated=Tiso_gene_7919}}
+
{{#set: molecular weight=951.992    }}
−
{{#set: in pathway=PWY-381|PWY490-3}}
+
{{#set: common name=L-thyroxine phenolic glucuronide|thyroxine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-|T4G}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-10606}}
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=synechocystis|athaliana|esiliculosus}}
+
−
{{#set: reconstruction category=manual}}
+
−
{{#set: reconstruction source=primary_network}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 19:49, 21 March 2018

Metabolite CPD-11398

  • smiles:
    • C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
  • common name:
    • L-thyroxine phenolic β-D-glucuronide
  • inchi key:
    • InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
  • molecular weight:
    • 951.992
  • Synonym(s):
    • L-thyroxine phenolic glucuronide
    • thyroxine glucuronide
    • beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
    • T4G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11398&oldid=44016"