Difference between revisions of "D-MYO-INOSITOL-13-BISPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] == * smiles: ** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-13-BISPHOSPHATE D-MYO-INOSITOL-13-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP([...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-13-BISPHOSPHATE D-MYO-INOSITOL-13-BISPHOSPHATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** D-myo-inositol (1,3)-bisphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 336.085 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 1D-myo-inositol (1,3)-bisphosphate | ||
+ | ** myo-inositol (1,3)-bisphosphate | ||
+ | ** inositol (1,3)-bisphosphate | ||
+ | ** Ins(1,3)P2 | ||
+ | ** I(1,3)P2 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10959]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
+ | * CAS : 103597-56-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201139 25201139] |
− | * | + | * HMDB : HMDB06234 |
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83242 83242] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04062 C04062] |
− | + | {{#set: smiles=C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)}} | |
− | {{#set: smiles= | + | {{#set: common name=D-myo-inositol (1,3)-bisphosphate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J}} |
− | {{#set: | + | {{#set: molecular weight=336.085 }} |
− | {{#set: molecular weight= | + | {{#set: common name=1D-myo-inositol (1,3)-bisphosphate|myo-inositol (1,3)-bisphosphate|inositol (1,3)-bisphosphate|Ins(1,3)P2|I(1,3)P2}} |
− | {{#set: | + | {{#set: produced by=RXN-10959}} |
− | {{#set: | + |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite D-MYO-INOSITOL-13-BISPHOSPHATE
- smiles:
- C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)
- common name:
- D-myo-inositol (1,3)-bisphosphate
- inchi key:
- InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J
- molecular weight:
- 336.085
- Synonym(s):
- 1D-myo-inositol (1,3)-bisphosphate
- myo-inositol (1,3)-bisphosphate
- inositol (1,3)-bisphosphate
- Ins(1,3)P2
- I(1,3)P2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)" cannot be used as a page name in this wiki.