Difference between revisions of "CPD-13914"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1535 PWY0-1535] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * common name: ** cyclic...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) |
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** cyclic-2,3-O-oxalyl-L-threonate |
| + | * inchi key: | ||
| + | ** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 189.101 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2,3-cyclic oxalyl theronolactone | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-12872]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12869]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383] |
| − | {{#set: | + | {{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}} |
| − | {{#set: | + | {{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=189.101 }} |
| − | {{#set: | + | {{#set: common name=2,3-cyclic oxalyl theronolactone}} |
| + | {{#set: consumed by=RXN-12872}} | ||
| + | {{#set: produced by=RXN-12869}} | ||
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD-13914
- smiles:
- C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
- common name:
- cyclic-2,3-O-oxalyl-L-threonate
- inchi key:
- InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
- molecular weight:
- 189.101
- Synonym(s):
- 2,3-cyclic oxalyl theronolactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)" cannot be used as a page name in this wiki.
