Difference between revisions of "ATDTD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDTD ATDTD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dTDP phosphotransferase * Synon...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDTD ATDTD] ==
−
* smiles:
+
* direction:
−
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
 
* common name:
 
* common name:
−
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** ATP:dTDP phosphotransferase
−
* molecular weight:
+
−
** 185.136   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14014]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[TTP]][c]
−
* [[DIHYDRODIPICSYN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 cytidine[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 dTTP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16529]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_13128]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: common name=ATP:dTDP phosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_16529|Tiso_gene_13128}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
{{#set: in pathway=}}
−
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=185.136    }}
+
−
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
−
{{#set: consumed by=RXN-14014}}
+
−
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Latest revision as of 19:50, 21 March 2018

Reaction ATDTD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:dTDP phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 cytidine[c] + 1.0 ATP[c] => 1.0 ADP[c] + 1.0 dTTP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ATDTD&oldid=44052"