Difference between revisions of "RXN-11484"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11484 RXN-11484] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11484 RXN-11484] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.47 EC-2.3.1.47] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[Pimeloyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[8-AMINO-7-OXONONANOATE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 a pimeloyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 L-alanine[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 8-amino-7-oxononanoate[c] '''+''' 1 CO2[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3555]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] | ||
+ | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-7147]], 8-amino-7-oxononanoate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7147 PWY-7147] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.3.1.47}} | |
− | + | {{#set: gene associated=Tiso_gene_3555}} | |
− | + | {{#set: in pathway=PWY-6519|PWY-7147}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Contents
Reaction RXN-11484
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Pimeloyl-ACPs[c] + 1 PROTON[c] + 1 L-ALPHA-ALANINE[c] => 1 ACP[c] + 1 8-AMINO-7-OXONONANOATE[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 a pimeloyl-[acp][c] + 1 H+[c] + 1 L-alanine[c] => 1 a holo-[acyl-carrier protein][c] + 1 8-amino-7-oxononanoate[c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3555
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
Pathways
- PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
- 9 reactions found over 11 reactions in the full pathway
- PWY-7147, 8-amino-7-oxononanoate biosynthesis II: PWY-7147
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-creinhardtii