Difference between revisions of "RXN-37"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * inchi key: ** InChIKey...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-37 RXN-37] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.2.1....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-37 RXN-37] ==
−
* smiles:
+
* direction:
−
** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
−
* common name:
+
−
** S-succinyl-dihydrolipoamide
+
−
* molecular weight:
+
−
** 306.414   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-30]][c] '''=>''' 1 [[CPD-35]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
−
* [[AKGDHe2r]]
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 4-acetamidobutanal[c] '''=>''' 1 4-acetamidobutanoate[c] '''+''' 1 NADH[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3513]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_7322]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-0]], putrescine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-0 PWY-0]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657579 90657579]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31231 31231]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17432 17432]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05050 R05050]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01169 C01169]
+
{{#set: ec number=EC-1.2.1.3}}
−
* HMDB : HMDB01177
+
{{#set: gene associated=Tiso_gene_3513|Tiso_gene_7322}}
−
{{#set: smiles=C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS}}
+
{{#set: in pathway=PWY-0}}
−
{{#set: inchi key=InChIKey=RJCJWONCSKSHES-VIFPVBQESA-M}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=S-succinyl-dihydrolipoamide}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: molecular weight=306.414    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed or produced by=AKGDHe2r}}
+

Latest revision as of 19:50, 21 March 2018

Reaction RXN-37

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 H2O[c] + 1 4-acetamidobutanal[c] => 1 4-acetamidobutanoate[c] + 1 NADH[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-0, putrescine degradation III: PWY-0
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-37&oldid=44083"