Difference between revisions of "RXN-15635"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15635 RXN-15635] == * direction: ** LEFT-TO-RIGHT * common name: ** ketopantoate_hydroxymethylt...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15635 RXN-15635] ==
* smiles:
+
* direction:
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
+
 
* common name:
 
* common name:
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
+
** ketopantoate_hydroxymethyltransferase
* molecular weight:
+
* ec number:
** 1015.898   
+
** [http://enzyme.expasy.org/EC/2.1.2.11 EC-2.1.2.11]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-16559]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[2-KETO-ISOVALERATE]][c] '''+''' 1 [[METHYLENETETRAHYDROMETHANOPTERIN]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-DEHYDROPANTOATE]][c] '''+''' 1 [[THMPT]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-methyl-2-oxobutanoate[c] '''+''' 1 5,10-methylene-tetrahydromethanopterin[c] '''+''' 1 H2O[c] '''=>''' 1 2-dehydropantoate[c] '''+''' 1 tetrahydromethanopterin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14465]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14466]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6654]], phosphopantothenate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
+
{{#set: common name=ketopantoate_hydroxymethyltransferase}}
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: ec number=EC-2.1.2.11}}
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
+
{{#set: gene associated=Tiso_gene_14465|Tiso_gene_14466}}
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
+
{{#set: in pathway=PWY-6654}}
{{#set: molecular weight=1015.898    }}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: consumed by=RXN-16559}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:50, 21 March 2018

Reaction RXN-15635

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ketopantoate_hydroxymethyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6654, phosphopantothenate biosynthesis III: PWY-6654
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links