Difference between revisions of "RXN-7984"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7984 RXN-7984] == * direction: ** LEFT-TO-RIGHT * common name: ** violaxanthin_de-epoxidase **...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7984 RXN-7984] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** violaxanthin_de-epoxidase |
| − | * | + | ** violaxanthin_de-_chloroplast |
| − | * | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** VDE | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[CPD1F-133]][c] '''+''' 1 [[ASCORBATE]][c] '''=>''' 1 [[CPD1F-131]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[L-DEHYDRO-ASCORBATE]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H+[c] '''+''' 1 violaxanthin[c] '''+''' 1 L-ascorbate[c] '''=>''' 1 antheraxanthin[c] '''+''' 1 H2O[c] '''+''' 1 L-dehydro-ascorbate[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Tiso_gene_16523]] |
| − | == | + | ** Source: [[annotation-in-silico_annotation]] |
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_1275]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_5666]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5945]], zeaxanthin, antheraxanthin and violaxanthin interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945] | ||
| + | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15353 15353] | |
| − | + | * LIGAND-RXN: | |
| − | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07178 R07178] |
| − | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=violaxanthin_de-epoxidase}} |
| − | + | {{#set: common name=violaxanthin_de-_chloroplast}} | |
| − | {{#set: | + | {{#set: common name=VDE}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_16523|Tiso_gene_1275|Tiso_gene_5666}} |
| − | {{#set: common name= | + | {{#set: in pathway=PWY-5945}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:51, 21 March 2018
Contents
Reaction RXN-7984
- direction:
- LEFT-TO-RIGHT
- common name:
- violaxanthin_de-epoxidase
- violaxanthin_de-_chloroplast
- Synonym(s):
- VDE
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H+[c] + 1 violaxanthin[c] + 1 L-ascorbate[c] => 1 antheraxanthin[c] + 1 H2O[c] + 1 L-dehydro-ascorbate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16523
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1275
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5666
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-5945, zeaxanthin, antheraxanthin and violaxanthin interconversion: PWY-5945
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
