Difference between revisions of "RXN-12184"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == * smiles: ** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12184 RXN-12184] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** ORF...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12184 RXN-12184] ==
* smiles:
+
* direction:
** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K
+
 
* common name:
 
* common name:
** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine
+
** polyketide_synthase
* molecular weight:
+
** ORF
** 1075.843   
+
** long_chain_acyl-_synthetase
 +
** acyl-_synthetase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
** UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)
 
** UDP-MurNAc-tetrapeptide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-11347]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CO-A]][c] '''+''' 1 [[CPD-17637]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-17638]][c] '''+''' 1 [[AMP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 coenzyme A[c] '''+''' 1 7-hydroxylaurate[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 7-hydroxylauroyl-CoA[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_348]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733]
 +
** '''8''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658175 90658175]
+
{{#set: common name=polyketide_synthase}}
* LIGAND-CPD:
+
{{#set: common name=ORF}}
** [http://www.genome.jp/dbget-bin/www_bget?C06432 C06432]
+
{{#set: common name=long_chain_acyl-_synthetase}}
{{#set: smiles=CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)}}
+
{{#set: common name=acyl-_synthetase}}
{{#set: inchi key=InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K}}
+
{{#set: ec number=EC-6.2.1.3}}
{{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine}}
+
{{#set: gene associated=Tiso_gene_9394|Tiso_gene_136|Tiso_gene_10876|Tiso_gene_135|Tiso_gene_4191|Tiso_gene_13394|Tiso_gene_500|Tiso_gene_7855|Tiso_gene_348}}
{{#set: molecular weight=1075.843    }}
+
{{#set: in pathway=PWY-6733}}
{{#set: common name=UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)|UDP-MurNAc-tetrapeptide}}
+
{{#set: reconstruction category=annotation}}
{{#set: consumed by=RXN-11347}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:51, 21 March 2018

Reaction RXN-12184

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • polyketide_synthase
    • ORF
    • long_chain_acyl-_synthetase
    • acyl-_synthetase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 7-hydroxylaurate[c] + 1 ATP[c] => 1 diphosphate[c] + 1 7-hydroxylauroyl-CoA[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6733, sporopollenin precursors biosynthesis: PWY-6733
    • 8 reactions found over 18 reactions in the full pathway

Reconstruction information

External links