|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=S-ADENMETSYN-RXN S-ADENMETSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| * common name: | | * common name: |
− | ** S-adenosylmethionine synthase 1 | + | ** 3-oxo-(9Z)-hexadecenoyl-CoA |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/2.5.1.6 EC-2.5.1.6] | + | ** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J |
| + | * molecular weight: |
| + | ** 1013.883 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 3-oxo-16:1-Δ9-CoA |
| + | ** 3-oxo-9-cis-hexadecenoyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-17791]] |
− | ** 1 [[WATER]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PPI]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-17790]] |
− | ** 1 H2O[c] '''+''' 1 L-methionine[c] '''+''' 1 ATP[c] '''=>''' 1 S-adenosyl-L-methionine[c] '''+''' 1 phosphate[c] '''+''' 1 diphosphate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_13443]] | + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[SAM-PWY]], S-adenosyl-L-methionine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=SAM-PWY SAM-PWY]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[METHIONINE-DEG1-PWY]], L-methionine degradation I (to L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-DEG1-PWY METHIONINE-DEG1-PWY]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[ETHYL-PWY]], ethylene biosynthesis I (plants): [http://metacyc.org/META/NEW-IMAGE?object=ETHYL-PWY ETHYL-PWY]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5912]], 2'-deoxymugineic acid phytosiderophore biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5912 PWY-5912]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5041]], S-adenosyl-L-methionine cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041] | + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[creinhardtii]]
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | *** [[athaliana]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA:
| + | {{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21080 21080]
| + | {{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}} |
− | * LIGAND-RXN:
| + | {{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00177 R00177]
| + | {{#set: molecular weight=1013.883 }} |
− | * UNIPROT:
| + | {{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P19358 P19358]
| + | {{#set: consumed by=RXN-17791}} |
− | ** [http://www.uniprot.org/uniprot/P18298 P18298]
| + | {{#set: produced by=RXN-17790}} |
− | ** [http://www.uniprot.org/uniprot/Q91X83 Q91X83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PNJ8 Q9PNJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54419 P54419]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56460 P56460]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JVV6 Q9JVV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CEE0 Q9CEE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O50163 O50163]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43762 P43762]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23686 P23686]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17562 P17562]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4Y8 Q7M4Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S992 Q9S992]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90862 Q90862]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13444 P13444]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31153 P31153]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00266 Q00266]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43281 P43281]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40320 P40320]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43280 P43280]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43282 P43282]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48498 P48498]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10659 P10659]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39465 Q39465]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48466 P48466]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49612 P49612]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49613 P49613]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78003 P78003]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49070 Q49070]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A817 P0A817]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50299 P50299]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22350 O22350]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24260 P24260]
| + | |
− | ** [http://www.uniprot.org/uniprot/O60198 O60198]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12642 Q12642]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=S-adenosylmethionine synthase 1}} | + | |
− | {{#set: ec number=EC-2.5.1.6}} | + | |
− | {{#set: gene associated=Tiso_gene_13443}} | + | |
− | {{#set: in pathway=SAM-PWY|METHIONINE-DEG1-PWY|ETHYL-PWY|PWY-5912|PWY-5041}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=creinhardtii|synechocystis|esiliculosus|athaliana}}
| + | |
− | {{#set: reconstruction category=manual}}
| + | |
− | {{#set: reconstruction source=primary_network}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation}}
| + | |