Difference between revisions of "Tiso gene 19642"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
(Created page with "Category:Gene == Gene Tiso_gene_19642 == * right end position: ** 2136 * transcription direction: ** POSITIVE * left end position: ** 29 * centisome position: ** 1.3488371...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
+
== Gene Tiso_gene_19642 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 2136
−
* common name:
+
* transcription direction:
−
** 71-hydroxychlorophyllide a
+
** POSITIVE
−
* molecular weight:
+
* left end position:
−
** 628.966    
+
** 29
 +
* centisome position:
 +
** 1.3488371    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-hydroxychlorophyllide a (misleading)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7677]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-7676]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2136}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657206 90657206]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=29}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16540 C16540]
+
{{#set: centisome position=1.3488371    }}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(CO)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: common name=71-hydroxychlorophyllide a}}
+
−
{{#set: molecular weight=628.966    }}
+
−
{{#set: common name=7-hydroxychlorophyllide a (misleading)}}
+
−
{{#set: consumed by=RXN-7677}}
+
−
{{#set: produced by=RXN-7676}}
+

Latest revision as of 19:51, 21 March 2018

Gene Tiso_gene_19642

  • right end position:
    • 2136
  • transcription direction:
    • POSITIVE
  • left end position:
    • 29
  • centisome position:
    • 1.3488371
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19642&oldid=44213"