Difference between revisions of "PWY-4861"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4861 PWY-4861] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4861 PWY-4861] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
−
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
+
 
* common name:
 
* common name:
−
** 7-dehydrodesmosterol
+
** UDP-D-galacturonate biosynthesis I (from UDP-D-glucuronate)
−
* molecular weight:
+
−
** 382.628   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5α-cholesta-5,7,24-trien-3β-ol
+
** UDP-galacturonic acid biosynthesis
 +
** UDP-GalA biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-27]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
−
* [[RXN66-26]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_12322]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4861 PWY-4861]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
+
{{#set: taxonomic range=TAX-3193}}
−
* LIGAND-CPD:
+
{{#set: common name=UDP-D-galacturonate biosynthesis I (from UDP-D-glucuronate)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
+
{{#set: common name=UDP-galacturonic acid biosynthesis|UDP-GalA biosynthesis}}
−
* HMDB : HMDB03896
+
{{#set: reaction found=1}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
+
{{#set: total reaction=1}}
−
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
+
{{#set: completion rate=100.0}}
−
{{#set: common name=7-dehydrodesmosterol}}
+
−
{{#set: molecular weight=382.628    }}
+
−
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
+
−
{{#set: consumed by=RXN66-27}}
+
−
{{#set: produced by=RXN66-26}}
+

Latest revision as of 19:17, 21 March 2018

Pathway PWY-4861

  • taxonomic range:
  • common name:
    • UDP-D-galacturonate biosynthesis I (from UDP-D-glucuronate)
  • Synonym(s):
    • UDP-galacturonic acid biosynthesis
    • UDP-GalA biosynthesis

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-4861&oldid=40707"