Difference between revisions of "Tiso gene 450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_450 == * right end position: ** 29312 * transcription direction: ** POSITIVE * left end position: ** 27086 * centisome position: ** 81.0642...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
+
== Gene Tiso_gene_450 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 29312
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 4-cis-undecenoyl-CoA
+
** 27086
−
* molecular weight:
+
* centisome position:
−
** 929.765    
+
** 81.064255    
 
* Synonym(s):
 
* Synonym(s):
−
** 4Z-undecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14775]]
+
* Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-14774]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=29312}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658173 90658173]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=27086}}
−
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J}}
+
{{#set: centisome position=81.064255   }}
−
{{#set: common name=4-cis-undecenoyl-CoA}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
{{#set: molecular weight=929.765   }}
+
−
{{#set: common name=4Z-undecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14775}}
+
−
{{#set: produced by=RXN-14774}}
+

Latest revision as of 19:51, 21 March 2018

Gene Tiso_gene_450

  • right end position:
    • 29312
  • transcription direction:
    • POSITIVE
  • left end position:
    • 27086
  • centisome position:
    • 81.064255
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_450&oldid=44249"