Difference between revisions of "NARP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13792 CPD-13792] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)[O-] * inchi key: ** InChIK...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NARP NARP] == * direction: ** LEFT-TO-RIGHT * common name: ** nicotinamide ribonucleotide phosphohy...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13792 CPD-13792] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NARP NARP] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YUFFSWGQGVEMMI-JLNKQSITSA-M
+
 
* common name:
 
* common name:
−
** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentenoate
+
** nicotinamide ribonucleotide phosphohydrolase
−
* molecular weight:
+
−
** 329.501   
+
 
* Synonym(s):
 
* Synonym(s):
−
** n-3 docosapentaenoic acid
 
−
** clupanodonic acid
 
−
** (7Z,10Z,13Z,16Z,19Z)-docosapentaenoate
 
−
** all-cis-7,10,13,16,19-docosapentaenoate
 
−
** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoic acid
 
−
** n-3 docosapentaenoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-13446]]
+
** 1.0 [[NICOTINAMIDE_NUCLEOTIDE]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[NICOTINAMIDE_RIBOSE]][c] '''+''' 1.0 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 β-nicotinamide D-ribonucleotide[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 1-(β-D ribofuranosyl)nicotinamide[c] '''+''' 1.0 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5911]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMFA04000044
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=nicotinamide ribonucleotide phosphohydrolase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40846589 40846589]
+
{{#set: gene associated=Tiso_gene_5911}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77224 77224]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16513 C16513]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB06528
+
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=YUFFSWGQGVEMMI-JLNKQSITSA-M}}
+
−
{{#set: common name=(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentenoate}}
+
−
{{#set: molecular weight=329.501    }}
+
−
{{#set: common name=n-3 docosapentaenoic acid|clupanodonic acid|(7Z,10Z,13Z,16Z,19Z)-docosapentaenoate|all-cis-7,10,13,16,19-docosapentaenoate|(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoic acid|n-3 docosapentaenoate}}
+
−
{{#set: produced by=RXN-13446}}
+

Latest revision as of 19:52, 21 March 2018

Reaction NARP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nicotinamide ribonucleotide phosphohydrolase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=NARP&oldid=44272"