Difference between revisions of "Tiso gene 13522"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=L...") |
(Created page with "Category:Gene == Gene Tiso_gene_13522 == * right end position: ** 6243 * transcription direction: ** POSITIVE * left end position: ** 5175 * centisome position: ** 82.8795...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_13522 == |
| − | * | + | * right end position: |
| − | ** | + | ** 6243 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 5175 |
| − | * | + | * centisome position: |
| − | ** | + | ** 82.87957 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[ATPASE-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | + | *** Assignment: ec-number | |
| − | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: right end position=6243}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=5175}} |
| − | {{#set: | + | {{#set: centisome position=82.87957 }} |
| − | {{#set: | + | {{#set: reaction associated=ATPASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:52, 21 March 2018
Gene Tiso_gene_13522
- right end position:
- 6243
- transcription direction:
- POSITIVE
- left end position:
- 5175
- centisome position:
- 82.87957
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
