Difference between revisions of "CPD-7524"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12946 == * Synonym(s): == Reactions associated == * 3.5.1.98-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C | ||
+ | * common name: | ||
+ | ** 7,9,9'-cis-neurosporene | ||
+ | * inchi key: | ||
+ | ** InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N | ||
+ | * molecular weight: | ||
+ | ** 538.898 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** proneurosporene | ||
+ | ** 7,9,9'-tri-cis-neurosporene | ||
+ | ** 7,9,9'-tricis-neurosporene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11357]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-11356]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C19759 C19759] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62463 62463] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244751 25244751] | ||
+ | {{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}} | ||
+ | {{#set: common name=7,9,9'-cis-neurosporene}} | ||
+ | {{#set: inchi key=InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N}} | ||
+ | {{#set: molecular weight=538.898 }} | ||
+ | {{#set: common name=proneurosporene|7,9,9'-tri-cis-neurosporene|7,9,9'-tricis-neurosporene}} | ||
+ | {{#set: consumed by=RXN-11357}} | ||
+ | {{#set: produced by=RXN-11356}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CPD-7524
- smiles:
- CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
- common name:
- 7,9,9'-cis-neurosporene
- inchi key:
- InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
- molecular weight:
- 538.898
- Synonym(s):
- proneurosporene
- 7,9,9'-tri-cis-neurosporene
- 7,9,9'-tricis-neurosporene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links