Difference between revisions of "INDOXYL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ANXANor ANXANor] == * direction: ** LEFT-TO-RIGHT * common name: ** antheraxanthin,NADH:oxygen oxid...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * common name: ** indoxyl * inchi k...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ANXANor ANXANor] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C2(C=CC1(=C(C(O)=CN1)C=2))
 
* common name:
 
* common name:
−
** antheraxanthin,NADH:oxygen oxidoreductase
+
** indoxyl
 +
* inchi key:
 +
** InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 133.149   
 
* Synonym(s):
 
* Synonym(s):
 +
** indole-3-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[PROTON]][u] '''+''' 1.0 [[CPD1F-131]][u] '''+''' 1.0 [[NADPH]][u] '''+''' 1.0 [[OXYGEN-MOLECULE]][u] '''=>''' 1.0 [[WATER]][u] '''+''' 1.0 [[NADP]][u] '''+''' 1.0 [[CPD1F-133]][u]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-15587]]
−
** 1.0 H+[u] '''+''' 1.0 antheraxanthin[u] '''+''' 1.0 NADPH[u] '''+''' 1.0 oxygen[u] '''=>''' 1.0 H2O[u] '''+''' 1.0 NADP+[u] '''+''' 1.0 violaxanthin[u]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18005]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_10919]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=antheraxanthin,NADH:oxygen oxidoreductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50591 50591]
−
{{#set: gene associated=Tiso_gene_18005|Tiso_gene_10919}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.45861.html 45861]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB04094
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17840 17840]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05658 C05658]
 +
{{#set: smiles=C2(C=CC1(=C(C(O)=CN1)C=2))}}
 +
{{#set: common name=indoxyl}}
 +
{{#set: inchi key=InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=133.149    }}
 +
{{#set: common name=indole-3-ol}}
 +
{{#set: reversible reaction associated=RXN-15587}}

Latest revision as of 19:52, 21 March 2018

Metabolite INDOXYL

  • smiles:
    • C2(C=CC1(=C(C(O)=CN1)C=2))
  • common name:
    • indoxyl
  • inchi key:
    • InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
  • molecular weight:
    • 133.149
  • Synonym(s):
    • indole-3-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=INDOXYL&oldid=44331"