Difference between revisions of "ALDDH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDDH ALDDH] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde dehydrogenase (acetaldehyd...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDDH ALDDH] ==
−
* smiles:
+
* direction:
−
** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
+
 
* common name:
 
* common name:
−
** S-sulfanylglutathione
+
** aldehyde dehydrogenase (acetaldehyde, NAD)
−
* molecular weight:
+
−
** 338.373   
+
 
* Synonym(s):
 
* Synonym(s):
−
** GSSH
 
−
** glutathione-sulfide
 
−
** glutathione persulfide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-15348]]
+
** 1.0 [[NAD]][c] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[ACETALD]][c] '''=>''' 2.0 [[PROTON]][c] '''+''' 1.0 [[ACET]][c] '''+''' 1.0 [[NADH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-10851]]
+
** 1.0 NAD+[c] '''+''' 1.0 H2O[c] '''+''' 1.0 acetaldehyde[c] '''=>''' 2.0 H+[c] '''+''' 1.0 acetate[c] '''+''' 1.0 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3513]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477]
+
{{#set: common name=aldehyde dehydrogenase (acetaldehyde, NAD)}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3513}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}}
+
−
{{#set: common name=S-sulfanylglutathione}}
+
−
{{#set: molecular weight=338.373    }}
+
−
{{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}}
+
−
{{#set: produced by=RXN-15348}}
+
−
{{#set: consumed or produced by=RXN-10851}}
+

Latest revision as of 19:52, 21 March 2018

Reaction ALDDH

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • aldehyde dehydrogenase (acetaldehyde, NAD)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NAD+[c] + 1.0 H2O[c] + 1.0 acetaldehyde[c] => 2.0 H+[c] + 1.0 acetate[c] + 1.0 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALDDH&oldid=44346"