Difference between revisions of "MANNURONATE-REDUCTASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8892 CPD-8892] == * smiles: ** CCCCCC=CCC=CC=CC=C[CH]1(O[CH]1CCCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNURONATE-REDUCTASE-RXN MANNURONATE-REDUCTASE-RXN] == * direction: ** REVERSIBLE * common name: *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNURONATE-REDUCTASE-RXN MANNURONATE-REDUCTASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** carbonyl_reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.131 EC-1.1.1.131] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[D-MANNONATE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''<=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[D-mannuronates]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 D-mannonate[c] '''+''' 1 NAD(P)+[c] '''<=>''' 1 NAD(P)H[c] '''+''' 1 D-mannuronate[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_20417]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10639 10639] | |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10635 10635] |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02456 R02456] | |
− | ** [http://www. | + | {{#set: direction=REVERSIBLE}} |
− | * | + | {{#set: common name=carbonyl_reductase}} |
− | ** [http://www. | + | {{#set: ec number=EC-1.1.1.131}} |
− | + | {{#set: gene associated=Tiso_gene_20417}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:53, 21 March 2018
Contents
Reaction MANNURONATE-REDUCTASE-RXN
- direction:
- REVERSIBLE
- common name:
- carbonyl_reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 D-MANNONATE[c] + 1 NAD-P-OR-NOP[c] <=> 1 NADH-P-OR-NOP[c] + 1 D-mannuronates[c] + 1 PROTON[c]
- With common name(s):
- 1 D-mannonate[c] + 1 NAD(P)+[c] <=> 1 NAD(P)H[c] + 1 D-mannuronate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_20417
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links