Difference between revisions of "CPD66-28"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17464 CPD-17464] == * smiles: ** CCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] == * smiles: ** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pregn-5-ene-3,20-dione |
+ | * inchi key: | ||
+ | ** InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 314.467 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-353]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=150901 150901] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.546029.html 546029] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63837 63837] |
− | {{#set: smiles= | + | {{#set: smiles=CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: | + | {{#set: common name=pregn-5-ene-3,20-dione}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=314.467 }} |
− | {{#set: produced by= | + | {{#set: produced by=RXN66-353}} |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite CPD66-28
- smiles:
- CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- pregn-5-ene-3,20-dione
- inchi key:
- InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N
- molecular weight:
- 314.467
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.