Difference between revisions of "3-Hydroxy-octanoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxy-octanoyl-ACPs 3-Hydroxy-octanoyl-ACPs] == * common name: ** a (3R)-3-hydroxyoctanoyl-...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxy-octanoyl-ACPs 3-Hydroxy-octanoyl-ACPs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a (3R)-3-hydroxyoctanoyl-[acp] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a β-hydroxyoctanoyl-[acp] | ||
+ | ** a β-hydroxyoctanoyl-[acyl-carrier-protein] | ||
+ | ** a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4.2.1.59-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9524]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a (3R)-3-hydroxyoctanoyl-[acp]}} | |
− | + | {{#set: common name=a β-hydroxyoctanoyl-[acp]|a β-hydroxyoctanoyl-[acyl-carrier-protein]|a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein]}} | |
− | + | {{#set: consumed by=4.2.1.59-RXN}} | |
− | + | {{#set: produced by=RXN-9524}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: consumed by= | + | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite 3-Hydroxy-octanoyl-ACPs
- common name:
- a (3R)-3-hydroxyoctanoyl-[acp]
- Synonym(s):
- a β-hydroxyoctanoyl-[acp]
- a β-hydroxyoctanoyl-[acyl-carrier-protein]
- a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (3R)-3-hydroxyoctanoyl-[acp" cannot be used as a page name in this wiki.
- "a β-hydroxyoctanoyl-[acp" cannot be used as a page name in this wiki.
- "a β-hydroxyoctanoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
- "a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.