Difference between revisions of "3-Hydroxy-octanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C * inchi key: **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxy-octanoyl-ACPs 3-Hydroxy-octanoyl-ACPs] == * common name: ** a (3R)-3-hydroxyoctanoyl-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPBQ MPBQ] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxy-octanoyl-ACPs 3-Hydroxy-octanoyl-ACPs] ==
* smiles:
+
** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C
+
* inchi key:
+
** InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N
+
 
* common name:
 
* common name:
** 2-methyl-6-phytyl-1,4-benzoquinol
+
** a (3R)-3-hydroxyoctanoyl-[acp]
* molecular weight:
+
** 402.659   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a β-hydroxyoctanoyl-[acp]
 +
** a β-hydroxyoctanoyl-[acyl-carrier-protein]
 +
** a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2542]]
+
* [[4.2.1.59-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2541]]
+
* [[RXN-9524]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a (3R)-3-hydroxyoctanoyl-[acp]}}
** [http://www.genome.jp/dbget-bin/www_bget?C15882 C15882]
+
{{#set: common name=a β-hydroxyoctanoyl-[acp]|a β-hydroxyoctanoyl-[acyl-carrier-protein]|a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein]}}
* CHEBI:
+
{{#set: consumed by=4.2.1.59-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75920 75920]
+
{{#set: produced by=RXN-9524}}
* METABOLIGHTS : MTBLC75920
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768135 71768135]
+
* HMDB : HMDB38959
+
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C=C(C)C(O)=1))C)C}}
+
{{#set: inchi key=InChIKey=GTWCNYRFOZKWTL-UOFXASEASA-N}}
+
{{#set: common name=2-methyl-6-phytyl-1,4-benzoquinol}}
+
{{#set: molecular weight=402.659    }}
+
{{#set: consumed by=RXN-2542}}
+
{{#set: produced by=RXN-2541}}
+

Latest revision as of 20:53, 21 March 2018

Metabolite 3-Hydroxy-octanoyl-ACPs

  • common name:
    • a (3R)-3-hydroxyoctanoyl-[acp]
  • Synonym(s):
    • a β-hydroxyoctanoyl-[acp]
    • a β-hydroxyoctanoyl-[acyl-carrier-protein]
    • a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (3R)-3-hydroxyoctanoyl-[acp" cannot be used as a page name in this wiki.
  • "a β-hydroxyoctanoyl-[acp" cannot be used as a page name in this wiki.
  • "a β-hydroxyoctanoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
  • "a (R)-3-hydroxyoctanoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.