Difference between revisions of "Lipid-linked-16-mannosyl-mannose-oligos"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10586 CPD-10586] == * smiles: ** CC(CO)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-linked-16-mannosyl-mannose-oligos Lipid-linked-16-mannosyl-mannose-oligos] == * common na...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10586 CPD-10586] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-linked-16-mannosyl-mannose-oligos Lipid-linked-16-mannosyl-mannose-oligos] ==
* smiles:
+
** CC(CO)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
+
* inchi key:
+
** InChIKey=OQIJRBFRXGIHMI-WKNWCLFJSA-N
+
 
* common name:
 
* common name:
** (25R)-5β-cholestane-3α,7α,26-triol
+
** a lipid-linked α(1->6)-D-mannosyl-D-mannose-oligosaccharide
* molecular weight:
+
** 420.674   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9843]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.4.1.232-RXN]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST04030020
+
{{#set: common name=a lipid-linked α(1->6)-D-mannosyl-D-mannose-oligosaccharide}}
* PUBCHEM:
+
{{#set: reversible reaction associated=2.4.1.232-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926093 46926093]
+
* HMDB : HMDB12455
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?c05444 c05444]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28540 28540]
+
* METABOLIGHTS : MTBLC28540
+
{{#set: smiles=CC(CO)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
+
{{#set: inchi key=InChIKey=OQIJRBFRXGIHMI-WKNWCLFJSA-N}}
+
{{#set: common name=(25R)-5β-cholestane-3α,7α,26-triol}}
+
{{#set: molecular weight=420.674    }}
+
{{#set: consumed by=RXN-9843}}
+

Latest revision as of 19:53, 21 March 2018

Metabolite Lipid-linked-16-mannosyl-mannose-oligos

  • common name:
    • a lipid-linked α(1->6)-D-mannosyl-D-mannose-oligosaccharide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a lipid-linked α(1->6)-D-mannosyl-D-mannose-oligosaccharide" cannot be used as a page name in this wiki.