Difference between revisions of "Tiso gene 18971"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...")
(Created page with "Category:Gene == Gene Tiso_gene_18971 == * right end position: ** 2449 * transcription direction: ** POSITIVE * left end position: ** 24 * centisome position: ** 0.8945210...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-720 CPD-720] ==
+
== Gene Tiso_gene_18971 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 2449
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 6-deoxotyphasterol
+
** 24
−
* molecular weight:
+
* centisome position:
−
** 434.701    
+
** 0.89452106    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxotyphasterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-4241]]
+
* Reaction: [[RXN-1104]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-1143]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-3422]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7498]]
 +
* [[PWY-1121]]
 +
* [[PWY-5168]]
 +
* [[PWY-7186]]
 +
* [[PWY-2181]]
 +
* [[PWY-361]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2449}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061346 16061346]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=24}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20717 20717]
+
{{#set: centisome position=0.89452106   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-1104|RXN-1143|RXN-3422}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15801 C15801]
+
{{#set: pathway associated=PWY-7498|PWY-1121|PWY-5168|PWY-7186|PWY-2181|PWY-361}}
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-DAWJDVIISA-N}}
+
−
{{#set: common name=6-deoxotyphasterol}}
+
−
{{#set: molecular weight=434.701   }}
+
−
{{#set: common name=deoxotyphasterol}}
+
−
{{#set: consumed by=RXN-4241}}
+

Latest revision as of 19:53, 21 March 2018

Gene Tiso_gene_18971

  • right end position:
    • 2449
  • transcription direction:
    • POSITIVE
  • left end position:
    • 24
  • centisome position:
    • 0.89452106
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18971&oldid=44442"