Difference between revisions of "CPD-9956"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == |
* smiles: | * smiles: | ||
− | ** CC(C)C(=C) | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ubiquinol-8 |
+ | * inchi key: | ||
+ | ** InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 729.137 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ubiquinol(8) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DHHB-METHYLTRANSFER-RXN]] | ||
+ | * [[NADHor_2m]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25074411 25074411] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61682 61682] |
− | * | + | * BIGG : q8h2 |
− | * | + | * HMDB : HMDB01060 |
− | {{#set: smiles=CC(C)C(=C) | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} |
− | {{#set: | + | {{#set: common name=ubiquinol-8}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=729.137 }} |
− | {{#set: common name= | + | {{#set: common name=ubiquinol(8)}} |
− | {{#set: | + | {{#set: produced by=DHHB-METHYLTRANSFER-RXN|NADHor_2m}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-9956
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- common name:
- ubiquinol-8
- inchi key:
- InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N
- molecular weight:
- 729.137
- Synonym(s):
- ubiquinol(8)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links