Difference between revisions of "CPD1F-4"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] == * common name: ** a tRNA precursor with a 5' extension * Synonym(s): =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * com...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == |
+ | * smiles: | ||
+ | ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) | ||
* common name: | * common name: | ||
− | ** | + | ** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al |
+ | * inchi key: | ||
+ | ** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N | ||
+ | * molecular weight: | ||
+ | ** 382.542 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** C25-allenic-apo-aldehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-698]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044] | ||
+ | {{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}} | ||
+ | {{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}} | ||
+ | {{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}} | ||
+ | {{#set: molecular weight=382.542 }} | ||
+ | {{#set: common name=C25-allenic-apo-aldehyde}} | ||
+ | {{#set: produced by=RXN-698}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD1F-4
- smiles:
- CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
- common name:
- (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
- inchi key:
- InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
- molecular weight:
- 382.542
- Synonym(s):
- C25-allenic-apo-aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links