Difference between revisions of "Tiso gene 18542"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_18542 == * Synonym(s): == Reactions associated == * Reaction: RXN-14264 ** Source: orthology-esiliculosus * Reaction: [[RXN0-2301]...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18542 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-14264]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN0-2301]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[LEU-DEG2-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-14264|RXN0-2301}} | |
− | + | {{#set: pathway associated=LEU-DEG2-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:54, 21 March 2018
Gene Tiso_gene_18542
- Synonym(s):
Reactions associated
- Reaction: RXN-14264
- Source: orthology-esiliculosus
- Reaction: RXN0-2301
- Source: orthology-esiliculosus