Difference between revisions of "Tiso gene 10326"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_10326 == * right end position: ** 5635 * transcription direction: ** POSITIVE * left end position: ** 3279 * centisome position: ** 37.9777...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10326 == |
− | * | + | * right end position: |
− | ** | + | ** 5635 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3279 |
− | * | + | * centisome position: |
− | ** | + | ** 37.97776 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NADH-DEHYDROG-A-RXN]] |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-6692]] | |
− | * [[ | + | * [[PWY-3781]] |
− | + | * [[PWY-5083]] | |
− | * [[ | + | * [[PWY0-1334]] |
+ | * [[PWY0-1335]] | ||
+ | * [[PWY-4302]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5635}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3279}} | |
− | + | {{#set: centisome position=37.97776 }} | |
− | + | {{#set: reaction associated=NADH-DEHYDROG-A-RXN}} | |
− | + | {{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:54, 21 March 2018
Gene Tiso_gene_10326
- right end position:
- 5635
- transcription direction:
- POSITIVE
- left end position:
- 3279
- centisome position:
- 37.97776
- Synonym(s):
Reactions associated
- Reaction: NADH-DEHYDROG-A-RXN
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation