Difference between revisions of "Tiso gene 12960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * inc...")
(Created page with "Category:Gene == Gene Tiso_gene_12960 == * right end position: ** 4643 * transcription direction: ** NEGATIVE * left end position: ** 657 * centisome position: ** 9.951529...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] ==
+
== Gene Tiso_gene_12960 ==
−
* smiles:
+
* right end position:
−
** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
+
** 4643
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
+
** 657
−
* molecular weight:
+
* centisome position:
−
** 382.542    
+
** 9.9515295    
 
* Synonym(s):
 
* Synonym(s):
−
** C25-allenic-apo-aldehyde
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PHOSPHOLIPASE-A2-RXN]]
−
* [[RXN-698]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-15065]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15067]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15068]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16138]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16139]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17735]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17736]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6725]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY66-397]]
 +
* [[PWY-6803]]
 +
* [[PWY-7409]]
 +
* [[PWY66-394]]
 +
* [[PWY66-395]]
 +
* [[PWY-7783]]
 +
* [[PWY-7417]]
 +
* [[PWY-7416]]
 +
* [[LIPASYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4643}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=657}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596]
+
{{#set: centisome position=9.9515295   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PHOSPHOLIPASE-A2-RXN|RXN-15065|RXN-15067|RXN-15068|RXN-16138|RXN-16139|RXN-17735|RXN-17736|RXN0-6725}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044]
+
{{#set: pathway associated=PWY66-397|PWY-6803|PWY-7409|PWY66-394|PWY66-395|PWY-7783|PWY-7417|PWY-7416|LIPASYN-PWY}}
−
{{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}}
+
−
{{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}}
+
−
{{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
+
−
{{#set: molecular weight=382.542   }}
+
−
{{#set: common name=C25-allenic-apo-aldehyde}}
+
−
{{#set: produced by=RXN-698}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_12960

  • right end position:
    • 4643
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 657
  • centisome position:
    • 9.9515295
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12960&oldid=44587"