Difference between revisions of "Tiso gene 6679"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_6679 == * right end position: ** 3307 * transcription direction: ** POSITIVE * left end position: ** 1527 * centisome position: ** 6.608959...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
+
== Gene Tiso_gene_6679 ==
* smiles:
+
* right end position:
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3307
* inchi key:
+
* transcription direction:
** InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J
+
** POSITIVE
* common name:
+
* left end position:
** icosapentaenoyl-CoA
+
** 1527
* molecular weight:
+
* centisome position:
** 1047.943    
+
** 6.608959    
 
* Synonym(s):
 
* Synonym(s):
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA
 
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA
 
** eicosapentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-13442]]
+
* Reaction: [[GLUTATHIONE-PEROXIDASE-RXN]]
* [[RXN-13430]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
* [[RXN-12978]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[DETOX1-PWY-1]]
 +
* [[PWY-4081]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=3307}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581014 71581014]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=1527}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73862 73862]
+
{{#set: centisome position=6.608959   }}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}}
{{#set: inchi key=InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J}}
+
{{#set: pathway associated=DETOX1-PWY-1|PWY-4081}}
{{#set: common name=icosapentaenoyl-CoA}}
+
{{#set: molecular weight=1047.943   }}
+
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA|eicosapentaenoyl-CoA}}
+
{{#set: consumed by=RXN-13442|RXN-13430}}
+
{{#set: produced by=RXN-12978}}
+

Latest revision as of 19:55, 21 March 2018

Gene Tiso_gene_6679

  • right end position:
    • 3307
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1527
  • centisome position:
    • 6.608959
  • Synonym(s):

Reactions associated

Pathways associated

External links