Difference between revisions of "HOMOCYSMET-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MET MET] == * smiles: ** CSCCC([N+])C([O-])=O * inchi key: ** InChIKey=FFEARJCKVFRZRR-BYPYZUCNS...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSMET-RXN HOMOCYSMET-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MET MET] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSMET-RXN HOMOCYSMET-RXN] ==
−
* smiles:
+
* direction:
−
** CSCCC([N+])C([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=FFEARJCKVFRZRR-BYPYZUCNSA-N
+
** [http://enzyme.expasy.org/EC/2.1.1.14 EC-2.1.1.14]
−
* common name:
+
−
** L-methionine
+
−
* molecular weight:
+
−
** 149.207   
+
 
* Synonym(s):
 
* Synonym(s):
−
** M
 
−
** met
 
−
** methionine
 
−
** L-met
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16165]]
+
* With identifiers:
−
* [[RXN0-6948]]
+
** 1 [[CPD-1302]][c] '''+''' 1 [[HOMO-CYS]][c] '''<=>''' 1 [[MET]][c] '''+''' 1 [[CPD-1301]][c]
−
* [[S-ADENMETSYN-RXN]]
+
* With common name(s):
−
* [[RME144]]
+
** 1 N5-methyl--tetrahydropteroyl tri-L-glutamate[c] '''+''' 1 L-homocysteine[c] '''<=>''' 1 L-methionine[c] '''+''' 1 tetrahydropteroyl tri-L-glutamate[c]
−
* [[METHIONINE--TRNA-LIGASE-RXN]]
+
 
−
== Reaction(s) known to produce the compound ==
+
== Genes associated with this reaction  ==
−
* [[RXN0-5063]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[R00946]]
+
* Gene: [[Tiso_gene_1602]]
−
* [[RXN-8340]]
+
** Source: [[annotation-experimental_annotation]]
−
* [[3.4.11.18-RXN]]
+
*** Assignment: AUTOMATED-NAME-MATCH
−
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
+
== Pathways  ==
−
* [[RXN0-949]]
+
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
−
* [[2.8.1.6-RXN]]
+
** '''5''' reactions found over '''6''' reactions in the full pathway
−
* [[RXN-14950]]
+
* [[PWY-5041]], S-adenosyl-L-methionine cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041]
−
* [[RXN-14957]]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
−
* [[RXN-14959]]
+
* [[PWY-6151]], S-adenosyl-L-methionine cycle I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6151 PWY-6151]
−
* [[HEMN-RXN]]
+
** '''4''' reactions found over '''6''' reactions in the full pathway
−
* [[HOMOCYSMETB12-RXN]]
+
* [[HSERMETANA-PWY]], L-methionine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=HSERMETANA-PWY HSERMETANA-PWY]
−
* [[1.8.4.14-RXN]]
+
** '''3''' reactions found over '''4''' reactions in the full pathway
−
* [[RXN-17473]]
+
* [[HOMOSER-METSYN-PWY]], L-methionine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
−
* [[RXN-17472]]
+
** '''4''' reactions found over '''5''' reactions in the full pathway
−
* [[MMUM-RXN]]
+
== Reconstruction information  ==
−
* [[RXN0-1342]]
+
* Category: [[annotation]]
−
* [[FORMYLMETHIONINE-DEFORMYLASE-RXN]]
+
** Source: [[annotation-experimental_annotation]]
−
* [[RXN-17878]]
+
*** Tool: [[pathwaytools]]
−
* [[RXN-17873]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-17877]]
+
*** Tool: [[pathwaytools]]
−
* [[RXN-17876]]
+
−
* [[RXN-17875]]
+
−
* [[RXN-17874]]
+
−
* [[RXN-14480]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[HOMOCYSMET-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 63-68-3
+
* RHEA:
−
* METABOLIGHTS : MTBLC57844
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21196 21196]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992087 6992087]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04405 R04405]
−
* HMDB : HMDB00696
+
* UNIPROT:
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P25665 P25665]
−
** [http://www.genome.jp/dbget-bin/www_bget?C00073 C00073]
+
** [http://www.uniprot.org/uniprot/P45331 P45331]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/Q9PN94 Q9PN94]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57844 57844]
+
** [http://www.uniprot.org/uniprot/O26869 O26869]
−
* BIGG : met__L
+
** [http://www.uniprot.org/uniprot/Q9JUT6 Q9JUT6]
−
{{#set: smiles=CSCCC([N+])C([O-])=O}}
+
** [http://www.uniprot.org/uniprot/Q9CG55 Q9CG55]
−
{{#set: inchi key=InChIKey=FFEARJCKVFRZRR-BYPYZUCNSA-N}}
+
** [http://www.uniprot.org/uniprot/P05694 P05694]
−
{{#set: common name=L-methionine}}
+
** [http://www.uniprot.org/uniprot/Q42699 Q42699]
−
{{#set: molecular weight=149.207    }}
+
** [http://www.uniprot.org/uniprot/Q39586 Q39586]
−
{{#set: common name=M|met|methionine|L-met}}
+
** [http://www.uniprot.org/uniprot/O48613 O48613]
−
{{#set: consumed by=RXN-16165|RXN0-6948|S-ADENMETSYN-RXN|RME144|METHIONINE--TRNA-LIGASE-RXN}}
+
** [http://www.uniprot.org/uniprot/P93263 P93263]
−
{{#set: produced by=RXN0-5063|R00946|RXN-8340|3.4.11.18-RXN|HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN|RXN0-949|2.8.1.6-RXN|RXN-14950|RXN-14957|RXN-14959|HEMN-RXN|HOMOCYSMETB12-RXN|1.8.4.14-RXN|RXN-17473|RXN-17472|MMUM-RXN|RXN0-1342|FORMYLMETHIONINE-DEFORMYLASE-RXN|RXN-17878|RXN-17873|RXN-17877|RXN-17876|RXN-17875|RXN-17874|RXN-14480}}
+
** [http://www.uniprot.org/uniprot/Q9UT19 Q9UT19]
−
{{#set: consumed or produced by=HOMOCYSMET-RXN}}
+
{{#set: direction=REVERSIBLE}}
 +
{{#set: ec number=EC-2.1.1.14}}
 +
{{#set: gene associated=Tiso_gene_1602}}
 +
{{#set: in pathway=PWY-702|PWY-5041|PWY-6151|HSERMETANA-PWY|HOMOSER-METSYN-PWY}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:55, 21 March 2018

Reaction HOMOCYSMET-RXN

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 N5-methyl--tetrahydropteroyl tri-L-glutamate[c] + 1 L-homocysteine[c] <=> 1 L-methionine[c] + 1 tetrahydropteroyl tri-L-glutamate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-702, L-methionine biosynthesis II: PWY-702
    • 5 reactions found over 6 reactions in the full pathway
  • PWY-5041, S-adenosyl-L-methionine cycle II: PWY-5041
    • 4 reactions found over 4 reactions in the full pathway
  • PWY-6151, S-adenosyl-L-methionine cycle I: PWY-6151
    • 4 reactions found over 6 reactions in the full pathway
  • HSERMETANA-PWY, L-methionine biosynthesis III: HSERMETANA-PWY
    • 3 reactions found over 4 reactions in the full pathway
  • HOMOSER-METSYN-PWY, L-methionine biosynthesis I: HOMOSER-METSYN-PWY
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HOMOCYSMET-RXN&oldid=44664"