Difference between revisions of "RXN-10039"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10039 RXN-10039] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10039 RXN-10039] ==
* smiles:
+
* direction:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
+
** [http://enzyme.expasy.org/EC/2.9.1.2 EC-2.9.1.2]
* common name:
+
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
+
* molecular weight:
+
** 414.713   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN66-14]]
+
** 1 [[SEPO3]][c] '''+''' 1 [[O-phospho-L-seryl-tRNASecs]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[Pi]][c] '''+''' 1 [[Charged-SEC-tRNAs]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 selenophosphate[c] '''+''' 1 an O-phospho-L-seryl-[tRNASec][c] '''+''' 1 H2O[c] '''=>''' 2 phosphate[c] '''+''' 1 an L-selenocysteinyl-[tRNAsec][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16385]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6281]], L-selenocysteine biosynthesis II (archaea and eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6281 PWY-6281]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08224 R08224]
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
+
{{#set: ec number=EC-2.9.1.2}}
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_16385}}
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
+
{{#set: in pathway=PWY-6281}}
* HMDB : HMDB06840
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
+
{{#set: molecular weight=414.713    }}
+
{{#set: produced by=RXN66-14}}
+

Latest revision as of 19:55, 21 March 2018

Reaction RXN-10039

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6281, L-selenocysteine biosynthesis II (archaea and eukaryotes): PWY-6281
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links