Difference between revisions of "3-oxo-petroselinoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-petroselinoyl-ACPs 3-oxo-petroselinoyl-ACPs] == * common name: ** a 3-oxo-petroselinoyl-[...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-petroselinoyl-ACPs 3-oxo-petroselinoyl-ACPs] ==
−
* smiles:
+
−
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
+
−
* inchi key:
+
−
** InChIKey=OZRNSSUDZOLUSN-LBPRGKRZSA-L
+
 
* common name:
 
* common name:
−
** 7,8-dihydrofolate monoglutamate
+
** a 3-oxo-petroselinoyl-[acp]
−
* molecular weight:
+
−
** 441.402   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7,8-pteroylglutamic acid
+
** a 3-oxo-petroselinoyl-[acyl-carrier-protein]
−
** 7,8-pteroylglutamate
+
−
** 7,8-dihydropteroyl monoglutamate
+
−
** H2PteGlu
+
−
** H2PteGlu1
+
−
** dihydrofolate
+
−
** 7,8-dihydropteroylglutamate
+
−
** 7,8-dihydrofolate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[R00939]]
+
* [[RXN-9552]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DIHYDROFOLATESYNTH-RXN]]
+
* [[RXN-8391]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 4033-27-6
+
{{#set: common name=a 3-oxo-petroselinoyl-[acp]}}
−
* METABOLIGHTS : MTBLC57451
+
{{#set: common name=a 3-oxo-petroselinoyl-[acyl-carrier-protein]}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-9552}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40480038 40480038]
+
{{#set: produced by=RXN-8391}}
−
* HMDB : HMDB01056
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00415 C00415]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57451 57451]
+
−
* BIGG : dhf
+
−
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}}
+
−
{{#set: inchi key=InChIKey=OZRNSSUDZOLUSN-LBPRGKRZSA-L}}
+
−
{{#set: common name=7,8-dihydrofolate monoglutamate}}
+
−
{{#set: molecular weight=441.402    }}
+
−
{{#set: common name=7,8-pteroylglutamic acid|7,8-pteroylglutamate|7,8-dihydropteroyl monoglutamate|H2PteGlu|H2PteGlu1|dihydrofolate|7,8-dihydropteroylglutamate|7,8-dihydrofolate}}
+
−
{{#set: consumed by=R00939}}
+
−
{{#set: produced by=DIHYDROFOLATESYNTH-RXN}}
+

Latest revision as of 19:55, 21 March 2018

Metabolite 3-oxo-petroselinoyl-ACPs

  • common name:
    • a 3-oxo-petroselinoyl-[acp]
  • Synonym(s):
    • a 3-oxo-petroselinoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-petroselinoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-petroselinoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-oxo-petroselinoyl-ACPs&oldid=44681"