Difference between revisions of "Menaquinols"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinols Menaquinols] == * common name: ** a menaquinol * Synonym(s): == Reaction(s) known...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Menaquinols Menaquinols] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a menaquinol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14107]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-5254]] | ||
| + | * [[RXN-15740]] | ||
| + | * [[RXN0-6554]] | ||
| + | * [[RXN-11046]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a menaquinol}} | |
| − | + | {{#set: consumed by=RXN-14107}} | |
| − | + | {{#set: produced by=RXN0-5254|RXN-15740|RXN0-6554|RXN-11046}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite Menaquinols
- common name:
- a menaquinol
- Synonym(s):
