Difference between revisions of "Tiso gene 15547"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-MALTOSE ALPHA-MALTOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_15547 == * right end position: ** 4534 * transcription direction: ** POSITIVE * left end position: ** 105 * centisome position: ** 2.112251...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15547 == |
− | * | + | * right end position: |
− | ** | + | ** 4534 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 105 |
− | * | + | * centisome position: |
− | ** | + | ** 2.112251 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[UNSPECIFIC-MONOOXYGENASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4534}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=105}} | |
− | + | {{#set: centisome position=2.112251 }} | |
− | + | {{#set: reaction associated=UNSPECIFIC-MONOOXYGENASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:56, 21 March 2018
Gene Tiso_gene_15547
- right end position:
- 4534
- transcription direction:
- POSITIVE
- left end position:
- 105
- centisome position:
- 2.112251
- Synonym(s):
Reactions associated
- Reaction: UNSPECIFIC-MONOOXYGENASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation