Difference between revisions of "RXN-14350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14350 RXN-14350] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14350 RXN-14350] ==
−
* smiles:
+
* direction:
−
** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
+
−
* common name:
+
−
** N-acetyl-α-D-glucosamine 1-phosphate
+
−
* molecular weight:
+
−
** 299.174   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[NAG1P-URIDYLTRANS-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[MALTOSE]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 2.0 [[Glucose]][c]
−
* [[RXN-16426]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 maltose[c] '''+''' 1.0 H2O[c] '''=>''' 2.0 glucose[c]
−
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4952]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4953]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256]
+
{{#set: gene associated=Tiso_gene_4952|Tiso_gene_4953}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776]
+
{{#set: reconstruction category=orthology}}
−
* BIGG : acgam1p
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* PUBCHEM:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937]
+
−
* HMDB : HMDB01367
+
−
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}}
+
−
{{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}}
+
−
{{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}}
+
−
{{#set: molecular weight=299.174    }}
+
−
{{#set: consumed by=NAG1P-URIDYLTRANS-RXN}}
+
−
{{#set: produced by=RXN-16426}}
+
−
{{#set: consumed or produced by=PHOSACETYLGLUCOSAMINEMUT-RXN}}
+

Latest revision as of 19:56, 21 March 2018

Reaction RXN-14350

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 maltose[c] + 1.0 H2O[c] => 2.0 glucose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14350&oldid=44770"