Difference between revisions of "1-5-L-Arabinooligosaccharides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-5-L-Arabinooligosaccharides 1-5-L-Arabinooligosaccharides] == * common name: ** a (1->5)-&alp...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-5-L-Arabinooligosaccharides 1-5-L-Arabinooligosaccharides] ==
* smiles:
+
** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
+
 
* common name:
 
* common name:
** linoleoyl-CoA
+
** a (1->5)-α-L-arabinan oligosaccharide
* molecular weight:
+
** 1025.937   
+
 
* Synonym(s):
 
* Synonym(s):
** cis,cis-octadeca-9,12-dienoyl-CoA
 
** (9Z,12Z)-octadeca-9,12-dienoyl-CoA
 
** 18:2(n-6)
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.19.3-RXN]]
+
* [[3.2.1.55-RXN]]
* [[RXN-16094]]
+
* [[LINOLEOYL-RXN]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LNLCCOAL]]
 
* [[RXN-9673]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a (1->5)-α-L-arabinan oligosaccharide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440]
+
{{#set: consumed by=3.2.1.55-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050]
+
* HMDB : HMDB01064
+
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}}
+
{{#set: common name=linoleoyl-CoA}}
+
{{#set: molecular weight=1025.937    }}
+
{{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}}
+
{{#set: consumed by=1.14.19.3-RXN|RXN-16094|LINOLEOYL-RXN}}
+
{{#set: produced by=LNLCCOAL|RXN-9673}}
+

Latest revision as of 19:56, 21 March 2018

Metabolite 1-5-L-Arabinooligosaccharides

  • common name:
    • a (1->5)-α-L-arabinan oligosaccharide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (1->5)-α-L-arabinan oligosaccharide" cannot be used as a page name in this wiki.