Difference between revisions of "CPD-12853"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDHmi ALCDHmi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogenase (ethanol:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDHmi ALCDHmi] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
 
* common name:
 
* common name:
** alcohol dehydrogenase (ethanol: NAD), mitochondrial
+
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
 +
* inchi key:
 +
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
 +
* molecular weight:
 +
** 396.655   
 
* Synonym(s):
 
* Synonym(s):
 +
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1.0 [[ACETALD]][m] '''+''' 1.0 [[NADH]][m] '''+''' 1.0 [[PROTON]][m] '''=>''' 1.0 [[NAD]][m] '''+''' 1.0 [[ETOH]][m]
+
* [[RXN-11881]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1.0 acetaldehyde[m] '''+''' 1.0 NADH[m] '''+''' 1.0 H+[m] '''=>''' 1.0 NAD+[m] '''+''' 1.0 ethanol[m]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_2052]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=alcohol dehydrogenase (ethanol: NAD), mitochondrial}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514956 102514956]
{{#set: gene associated=Tiso_gene_2052}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
{{#set: in pathway=}}
+
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=396.655    }}
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
 +
{{#set: produced by=RXN-11881}}

Latest revision as of 19:57, 21 March 2018

Metabolite CPD-12853

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • common name:
    • 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
  • inchi key:
    • InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
  • molecular weight:
    • 396.655
  • Synonym(s):
    • cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.