Difference between revisions of "PItm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == * smiles: ** C1(=C(NC=N1)CC[N+]) * inchi key: ** InChIKey=NTYJJOPFIAHUR...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PItm PItm] == * direction: ** REVERSIBLE * common name: ** phosphate transport, mitochondrial * Syn...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PItm PItm] ==
* smiles:
+
* direction:
** C1(=C(NC=N1)CC[N+])
+
** REVERSIBLE
* inchi key:
+
** InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** histamine
+
** phosphate transport, mitochondrial
* molecular weight:
+
** 112.154   
+
 
* Synonym(s):
 
* Synonym(s):
** peremin
 
** 1H-Imidazole-4-ethanamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9600]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[Pi]][c] '''+''' 1.0 [[PROTON]][c] '''<=>''' 1.0 [[Pi]][m] '''+''' 1.0 [[PROTON]][m]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 phosphate[c] '''+''' 1.0 H+[c] '''<=>''' 1.0 phosphate[m] '''+''' 1.0 H+[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7472]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 51-45-6
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: common name=phosphate transport, mitochondrial}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201573 25201573]
+
{{#set: gene associated=Tiso_gene_7472}}
* HMDB : HMDB00870
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C00388 C00388]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58432 58432]
+
* METABOLIGHTS : MTBLC58432
+
{{#set: smiles=C1(=C(NC=N1)CC[N+])}}
+
{{#set: inchi key=InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O}}
+
{{#set: common name=histamine}}
+
{{#set: molecular weight=112.154    }}
+
{{#set: common name=peremin|1H-Imidazole-4-ethanamine}}
+
{{#set: consumed by=RXN-9600}}
+

Latest revision as of 19:57, 21 March 2018

Reaction PItm

  • direction:
    • REVERSIBLE
  • common name:
    • phosphate transport, mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 phosphate[c] + 1.0 H+[c] <=> 1.0 phosphate[m] + 1.0 H+[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links