Difference between revisions of "Tiso gene 13203"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_13203 == * right end position: ** 5268 * transcription direction: ** POSITIVE * left end position: ** 4651 * centisome position: ** 72.0303...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] ==
+
== Gene Tiso_gene_13203 ==
* smiles:
+
* right end position:
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 5268
* inchi key:
+
* transcription direction:
** InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
+
** POSITIVE
* common name:
+
* left end position:
** 3-dehydro-6-hydroxyteasterone
+
** 4651
* molecular weight:
+
* centisome position:
** 448.685    
+
** 72.03035    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.6.3.1-RXN]]
* [[RXN-11535]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=5268}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515138 102515138]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: left end position=4651}}
{{#set: inchi key=InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N}}
+
{{#set: centisome position=72.03035   }}
{{#set: common name=3-dehydro-6-hydroxyteasterone}}
+
{{#set: reaction associated=3.6.3.1-RXN}}
{{#set: molecular weight=448.685   }}
+
{{#set: produced by=RXN-11535}}
+

Latest revision as of 19:57, 21 March 2018

Gene Tiso_gene_13203

  • right end position:
    • 5268
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4651
  • centisome position:
    • 72.03035
  • Synonym(s):

Reactions associated

Pathways associated

External links