Difference between revisions of "Tiso gene 15962"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...") |
(Created page with "Category:Gene == Gene Tiso_gene_15962 == * right end position: ** 2824 * transcription direction: ** POSITIVE * left end position: ** 307 * centisome position: ** 6.562634...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15962 == |
− | * | + | * right end position: |
− | ** | + | ** 2824 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 307 |
− | * | + | * centisome position: |
− | ** | + | ** 6.562634 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEROXID-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-12440]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14240]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15288]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-17352]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-3521]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-8635]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7214]] | ||
+ | * [[PWY-6824]] | ||
+ | * [[PWY-6959]] | ||
+ | * [[PWY-5461]] | ||
+ | * [[PWY-7445]] | ||
+ | * [[PWY-5469]] | ||
+ | * [[PWY-5466]] | ||
+ | * [[PWY-6960]] | ||
+ | * [[PWY-6961]] | ||
+ | * [[PWY-2261]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2824}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=307}} | |
− | + | {{#set: centisome position=6.562634 }} | |
− | + | {{#set: reaction associated=PEROXID-RXN|RXN-12440|RXN-14240|RXN-15288|RXN-17352|RXN-3521|RXN-8635}} | |
− | + | {{#set: pathway associated=PWY-7214|PWY-6824|PWY-6959|PWY-5461|PWY-7445|PWY-5469|PWY-5466|PWY-6960|PWY-6961|PWY-2261}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:57, 21 March 2018
Gene Tiso_gene_15962
- right end position:
- 2824
- transcription direction:
- POSITIVE
- left end position:
- 307
- centisome position:
- 6.562634
- Synonym(s):
Reactions associated
- Reaction: PEROXID-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12440
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-14240
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-15288
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17352
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-3521
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-8635
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation