|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
− | * ec number: | + | * common name: |
− | ** [http://enzyme.expasy.org/EC/1.3.5.1 EC-1.3.5.1] | + | ** (5α)-campestan-3-one |
| + | * inchi key: |
| + | ** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N |
| + | * molecular weight: |
| + | ** 400.687 |
| * Synonym(s): | | * Synonym(s): |
| + | ** methylcholestanone |
| + | ** (24R)-24-methyl-5α-cholestan-3-one |
| + | ** 3-dehydro-campestanol |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-4230]] |
− | ** 1 [[Ubiquinones]][c] '''+''' 1 [[SUC]][c] '''=>''' 1 [[Ubiquinols]][c] '''+''' 1 [[FUM]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-711]] |
− | ** 1 a ubiquinone[c] '''+''' 1 succinate[c] '''=>''' 1 an ubiquinol[c] '''+''' 1 fumarate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | == Pathways ==
| + | |
− | * [[PWY0-1353]], succinate to cytochrome bd oxidase electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1353 PWY0-1353] | + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-3781]], aerobic respiration I (cytochrome c): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3781 PWY-3781]
| + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7279]], aerobic respiration II (cytochrome c) (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7279 PWY-7279]
| + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY0-1329]], succinate to cytochrome bo oxidase electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1329 PWY0-1329]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-4302]], aerobic respiration III (alternative oxidase pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4302 PWY-4302]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398] | + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13713 13713] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061343 16061343] |
− | * LIGAND-RXN:
| + | * HMDB : HMDB12116 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R02164 R02164]
| + | * CHEBI: |
− | * PIR:
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18533 18533] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T50081 T50081]
| + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T46878 T46878] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T41753 T41753] | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T37633 T37633] | + | {{#set: common name=(5α)-campestan-3-one}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11245 T11245]
| + | {{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11229 T11229]
| + | {{#set: molecular weight=400.687 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11218 T11218] | + | {{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78180 S78180]
| + | {{#set: consumed by=RXN-4230}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78179 S78179] | + | {{#set: produced by=RXN-711}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78178 S78178]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S74810 S74810]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S62756 S62756]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S62755 S62755]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S59115 S59115]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S59114 S59114]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S56817 S56817]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S34793 S34793]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S26978 S26978]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S25968 S25968]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=RDBYIS RDBYIS]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PT0094 PT0094]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0336 JX0336]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I38895 I38895]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D81388 D81388]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D71712 D71712]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D32394 D32394]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C32394 C32394]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B58930 B58930]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B32394 B32394]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A56660 A56660]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A45159 A45159]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A42792 A42792]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/P35720 P35720]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26266 Q26266]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21913 P21913]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZZR2 Q9ZZR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21911 P21911]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZEA1 Q9ZEA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PI67 Q9PI67]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21912 P21912]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31040 P31040]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CQA3 Q9CQA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21801 P21801]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35721 P35721]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32420 P32420]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00711 Q00711]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47052 P47052]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48932 P48932]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48934 P48934]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48935 P48935]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48933 P48933]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73723 P73723]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80481 P80481]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80482 P80482]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80480 P80480]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9T584 Q9T584]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80479 P80479]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80478 P80478]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09508 Q09508]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59659 Q59659]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UTJ7 Q9UTJ7]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: ec number=EC-1.3.5.1}} | + | |
− | {{#set: in pathway=PWY0-1353|PWY-3781|PWY-7279|PWY0-1329|PWY-4302|PWY66-398}} | + | |
− | {{#set: reconstruction category=manual}} | + | |
− | {{#set: reconstruction source=primary_network}} | + | |