Difference between revisions of "EPISTEROL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11662 RXN-11662] == * direction: ** REVERSIBLE * common name: ** 3-hydroxyacyl-_dehydrogenase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11662 RXN-11662] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
 
* common name:
 
* common name:
** 3-hydroxyacyl-_dehydrogenase
+
** episterol
** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
+
* inchi key:
** hydroxyacyl-coenzyme_a_mitochondrial
+
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
+
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN3O-218]]
** 1 [[NAD]][c] '''+''' 1 [[S-3-HYDROXYBUTANOYL-COA]][c] '''<=>''' 1 [[ACETOACETYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxybutanoyl-CoA[c] '''<=>''' 1 acetoacetyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_14262]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_18839]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_5857]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[esiliculosus]]
+
** [[pantograph]]-[[creinhardtii]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[Tiso_gene_14027]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_18838]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_16703]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[Tiso_gene_14026]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[P162-PWY]], L-glutamate degradation V (via hydroxyglutarate): [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY]
+
** '''4''' reactions found over '''11''' reactions in the full pathway
+
* [[PWY-7216]], (R)- and (S)-3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7216 PWY-7216]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[CENTFERM-PWY]], pyruvate fermentation to butanoate: [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-5177]], glutaryl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583]
+
** '''4''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
+
** '''4''' reactions found over '''6''' reactions in the full pathway
+
* [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401]
+
** '''5''' reactions found over '''17''' reactions in the full pathway
+
* [[PWY-7778]], 2-methylpropene degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778]
+
** '''2''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-7779]], methyl tert-butyl ether degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7779 PWY-7779]
+
** '''2''' reactions found over '''10''' reactions in the full pathway
+
* [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
+
** '''8''' reactions found over '''16''' reactions in the full pathway
+
* [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863]
+
** '''5''' reactions found over '''11''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[creinhardtii]]
+
*** [[athaliana]]
+
*** [[esiliculosus]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30799 30799]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
* LIGAND-RXN:
+
* HMDB : HMDB06847
** [http://www.genome.jp/dbget-bin/www_bget?R01975 R01975]
+
* CHEBI:
{{#set: direction=REVERSIBLE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
{{#set: common name=3-hydroxyacyl-_dehydrogenase}}
+
* LIGAND-CPD:
{{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
{{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
{{#set: ec number=EC-1.1.1.35}}
+
{{#set: common name=episterol}}
{{#set: gene associated=Tiso_gene_14262|Tiso_gene_18839|Tiso_gene_5857|Tiso_gene_14027|Tiso_gene_18838|Tiso_gene_16703|Tiso_gene_14026}}
+
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
{{#set: in pathway=P162-PWY|PWY-7216|CENTFERM-PWY|PWY-5177|PWY-6583|PWY-6883|PWY-7401|PWY-7778|PWY-7779|PWY-5789|PWY-6863}}
+
{{#set: molecular weight=398.671    }}
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN3O-218}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=creinhardtii|athaliana|esiliculosus}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite EPISTEROL

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
  • common name:
    • episterol
  • inchi key:
    • InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))" cannot be used as a page name in this wiki.