Difference between revisions of "CPD-236"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == |
* smiles: | * smiles: | ||
| − | ** C1( | + | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** gibberellin A29 |
| + | * inchi key: | ||
| + | ** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 347.387 |
* Synonym(s): | * Synonym(s): | ||
| + | ** GA29 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-113]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040] |
| − | * | + | * LIGAND-CPD: |
| − | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096] |
| − | {{#set: smiles=C1( | + | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=gibberellin A29}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=347.387 }} |
| − | {{#set: | + | {{#set: common name=GA29}} |
| + | {{#set: produced by=RXN-113}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-236
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A29
- inchi key:
- InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
- molecular weight:
- 347.387
- Synonym(s):
- GA29
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.
