Difference between revisions of "Aryl-Alcohol"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * smiles: ** COC1(=C(O)C=CC(C(O)CO)=C1) * inchi key: ** InChIKey=FBWPWW...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-Alcohol Aryl-Alcohol] == * common name: ** a phenol * Synonym(s): ** an aromatic alcohol *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-Alcohol Aryl-Alcohol] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a phenol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an aromatic alcohol |
| − | ** | + | ** aryl alcohol |
| − | ** | + | ** an aryl alcohol |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ARYLSULFAT-RXN]] | ||
| + | * [[ARYLDIALKYLPHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[ARYL-ALCOHOL-DEHYDROGENASE-NADP+-RXN]] |
| + | * [[ARYL-SULFOTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a phenol}} | |
| − | + | {{#set: common name=an aromatic alcohol|aryl alcohol|an aryl alcohol}} | |
| − | + | {{#set: produced by=ARYLSULFAT-RXN|ARYLDIALKYLPHOSPHATASE-RXN}} | |
| − | + | {{#set: reversible reaction associated=ARYL-ALCOHOL-DEHYDROGENASE-NADP+-RXN|ARYL-SULFOTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite Aryl-Alcohol
- common name:
- a phenol
- Synonym(s):
- an aromatic alcohol
- aryl alcohol
- an aryl alcohol
