Difference between revisions of "Tiso gene 15880"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_15880 == * right end position: ** 2220 * transcription direction: ** POSITIVE * left end position: ** 107 * centisome position: ** 2.258813...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_15880 == |
| − | * | + | * right end position: |
| − | ** | + | ** 2220 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 107 |
| − | * | + | * centisome position: |
| − | ** | + | ** 2.2588136 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[RXN-9988]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | == | + | *** Assignment: automated-name-match |
| − | * [[ | + | == Pathways associated == |
| + | * [[PWY-6138]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: right end position=2220}} |
| − | {{#set: | + | {{#set: transcription direction=POSITIVE}} |
| − | {{#set: | + | {{#set: left end position=107}} |
| − | {{#set: | + | {{#set: centisome position=2.2588136 }} |
| − | {{#set: | + | {{#set: reaction associated=RXN-9988}} |
| − | {{#set: | + | {{#set: pathway associated=PWY-6138}} |
Latest revision as of 19:18, 21 March 2018
Gene Tiso_gene_15880
- right end position:
- 2220
- transcription direction:
- POSITIVE
- left end position:
- 107
- centisome position:
- 2.2588136
- Synonym(s):
Reactions associated
- Reaction: RXN-9988
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
