Difference between revisions of "TREHALOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-7-aminomethyl-7-deazaguanine tRNA-with-7-aminomethyl-7-deazaguanine] == * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * common n...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == |
+ | * smiles: | ||
+ | ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O | ||
* common name: | * common name: | ||
− | ** | + | ** α,α-trehalose |
+ | * inchi key: | ||
+ | ** InChIKey=HDTRYLNUVZCQOY-LIZSDCNHSA-N | ||
+ | * molecular weight: | ||
+ | ** 342.299 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α-D-glucopyranosyl α-D-glucopyranoside |
+ | ** α-D-Glcp-(1↔1)-α-D-Glcp | ||
+ | ** D-(+)-trehalose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[TREHALA-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TREHALOSEPHOSPHA-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 99-20-7 |
− | {{#set: common name= | + | * BIGG : tre |
− | {{#set: consumed by= | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7427 7427] |
+ | * KEGG-GLYCAN : G00293 | ||
+ | * HMDB : HMDB00975 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01083 C01083] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.7149.html 7149] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16551 16551] | ||
+ | * METABOLIGHTS : MTBLC16551 | ||
+ | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O}} | ||
+ | {{#set: common name=α,α-trehalose}} | ||
+ | {{#set: inchi key=InChIKey=HDTRYLNUVZCQOY-LIZSDCNHSA-N}} | ||
+ | {{#set: molecular weight=342.299 }} | ||
+ | {{#set: common name=α-D-glucopyranosyl α-D-glucopyranoside|α-D-Glcp-(1↔1)-α-D-Glcp|D-(+)-trehalose}} | ||
+ | {{#set: consumed by=TREHALA-RXN}} | ||
+ | {{#set: produced by=TREHALOSEPHOSPHA-RXN}} |
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite TREHALOSE
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O
- common name:
- α,α-trehalose
- inchi key:
- InChIKey=HDTRYLNUVZCQOY-LIZSDCNHSA-N
- molecular weight:
- 342.299
- Synonym(s):
- α-D-glucopyranosyl α-D-glucopyranoside
- α-D-Glcp-(1↔1)-α-D-Glcp
- D-(+)-trehalose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 99-20-7
- BIGG : tre
- PUBCHEM:
- KEGG-GLYCAN : G00293
- HMDB : HMDB00975
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16551